C23H35N5O4S — CID 91114883
[3a-[[5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(2-ethoxyethylamino)-6-methylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]methanol (PubChem CID 91114883) has the molecular formula C23H35N5O4S and a molecular weight of 477.63 g/mol. Its IUPAC name is [3a-[[5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(2-ethoxyethylamino)-6-methylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]methanol.
| Compound Name | [3a-[[5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(2-ethoxyethylamino)-6-methylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 91114883 |
| Molecular Formula | C23H35N5O4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [3a-[[5-(4,5-dimethyl-1,3-thiazol-2-yl)-2-(2-ethoxyethylamino)-6-methylpyrimidin-4-yl]amino]-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-6-yl]methanol |
| SMILES | CCOCCNc1nc(C)c(-c2nc(C)c(C)s2)c(NC23CCC(CO)C2OC(C)(C)O3)n1 |
| InChI | InChI=1S/C23H35N5O4S/c1-7-30-11-10-24-21-26-14(3)17(20-25-13(2)15(4)33-20)19(27-21)28-23-9-8-16(12-29)18(23)31-22(5,6)32-23/h16,18,29H,7-12H2,1-6H3,(H2,24,26,27,28) |
| InChIKey | RHRRZVIQZMVKCI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|