C28H39N7O4S — CID 90875901
1-[2-[[5-(1,3-benzothiazol-2-yl)-4-[[6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]amino]-6-methylpyrimidin-2-yl]amino]ethyl]-3-tert-butylurea (PubChem CID 90875901) has the molecular formula C28H39N7O4S and a molecular weight of 569.73 g/mol. Its IUPAC name is 1-[2-[[5-(1,3-benzothiazol-2-yl)-4-[[6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]amino]-6-methylpyrimidin-2-yl]amino]ethyl]-3-tert-butylurea.
| Compound Name | 1-[2-[[5-(1,3-benzothiazol-2-yl)-4-[[6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]amino]-6-methylpyrimidin-2-yl]amino]ethyl]-3-tert-butylurea |
|---|---|
| PubChem CID | 90875901 |
| Molecular Formula | C28H39N7O4S |
| Molecular Weight | 569.73 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | 1-[2-[[5-(1,3-benzothiazol-2-yl)-4-[[6-(hydroxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-3a-yl]amino]-6-methylpyrimidin-2-yl]amino]ethyl]-3-tert-butylurea |
| SMILES | Cc1nc(NCCNC(=O)NC(C)(C)C)nc(NC23CCC(CO)C2OC(C)(C)O3)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H39N7O4S/c1-16-20(23-32-18-9-7-8-10-19(18)40-23)22(33-24(31-16)29-13-14-30-25(37)35-26(2,3)4)34-28-12-11-17(15-36)21(28)38-27(5,6)39-28/h7-10,17,21,36H,11-15H2,1-6H3,(H2,30,35,37)(H2,29,31,33,34) |
| InChIKey | CXAULEBPLYJBNJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|