C28H30F3N5OS — CID 162587026
[(1S,2R,3S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol (PubChem CID 162587026) has the molecular formula C28H30F3N5OS and a molecular weight of 541.64 g/mol. Its IUPAC name is [(1S,2R,3S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol.
| Compound Name | [(1S,2R,3S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 162587026 |
| Molecular Formula | C28H30F3N5OS |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [(1S,2R,3S)-3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-[[2-(trifluoromethyl)phenyl]methylamino]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
| SMILES | Cc1nc(NCc2ccccc2C(F)(F)F)nc(N[C@@]2(C)CC[C@H](CO)[C@H]2C)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H30F3N5OS/c1-16-19(15-37)12-13-27(16,3)36-24-23(25-34-21-10-6-7-11-22(21)38-25)17(2)33-26(35-24)32-14-18-8-4-5-9-20(18)28(29,30)31/h4-11,16,19,37H,12-15H2,1-3H3,(H2,32,33,35,36)/t16-,19-,27+/m1/s1 |
| InChIKey | GRMHYDJGQZDVOR-TUZCJGOLSA-N |
| XLogP | 6.90 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |