C23H29F3N6O3S — CID 90693070
1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(2-methoxyethylamino)methyl]cyclopentane-1,2-diol (PubChem CID 90693070) has the molecular formula C23H29F3N6O3S and a molecular weight of 526.59 g/mol. Its IUPAC name is 1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(2-methoxyethylamino)methyl]cyclopentane-1,2-diol.
| Compound Name | 1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(2-methoxyethylamino)methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90693070 |
| Molecular Formula | C23H29F3N6O3S |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(2-methoxyethylamino)methyl]cyclopentane-1,2-diol |
| SMILES | COCCNCC1CCC(O)(Nc2nc(NCC(F)(F)F)nc(C)c2-c2nc3ccccc3s2)C1O |
| InChI | InChI=1S/C23H29F3N6O3S/c1-13-17(20-30-15-5-3-4-6-16(15)36-20)19(31-21(29-13)28-12-23(24,25)26)32-22(34)8-7-14(18(22)33)11-27-9-10-35-2/h3-6,14,18,27,33-34H,7-12H2,1-2H3,(H2,28,29,31,32) |
| InChIKey | CGTSFWBGEFZQOM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|