C23H27F3N6O4S2 — CID 162589518
(1S,2R,3R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclopentane-1,2-diol (PubChem CID 162589518) has the molecular formula C23H27F3N6O4S2 and a molecular weight of 572.64 g/mol. Its IUPAC name is (1S,2R,3R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162589518 |
| Molecular Formula | C23H27F3N6O4S2 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | (1S,2R,3R)-1-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-3-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(F)(F)F)nc(N[C@]2(O)CC[C@H](CN3CCCS3(=O)=O)[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H27F3N6O4S2/c1-13-17(20-29-15-5-2-3-6-16(15)37-20)19(30-21(28-13)27-12-23(24,25)26)31-22(34)8-7-14(18(22)33)11-32-9-4-10-38(32,35)36/h2-3,5-6,14,18,33-34H,4,7-12H2,1H3,(H2,27,28,30,31)/t14-,18-,22+/m1/s1 |
| InChIKey | QTQSVBOTDUHMPJ-KEQGGVEFSA-N |
| XLogP | 2.94 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|