C28H31F3N6O3S — CID 163984577
(1S,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-2-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]amino]-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 163984577) has the molecular formula C28H31F3N6O3S and a molecular weight of 588.66 g/mol. Its IUPAC name is (1S,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-2-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]amino]-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-2-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]amino]-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 163984577 |
| Molecular Formula | C28H31F3N6O3S |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (1S,2R,3R)-3-(hydroxymethyl)-1-[[6-methyl-2-[[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]amino]-5-([1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCC(C)(C)c2cccc(C(F)(F)F)c2)nc(N[C@]2(O)CC[C@H](CO)[C@H]2O)c1-c1nc2cnccc2s1 |
| InChI | InChI=1S/C28H31F3N6O3S/c1-15-21(24-35-19-12-32-10-8-20(19)41-24)23(37-27(40)9-7-16(13-38)22(27)39)36-25(34-15)33-14-26(2,3)17-5-4-6-18(11-17)28(29,30)31/h4-6,8,10-12,16,22,38-40H,7,9,13-14H2,1-3H3,(H2,33,34,36,37)/t16-,22-,27+/m1/s1 |
| InChIKey | TVDGNBGZDLFSRZ-NNLLZSKOSA-N |
| XLogP | 4.73 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|