C26H27N5O5S — CID 143946761
(1R,2R,3R)-1-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-(1,3-benzothiazol-2-yl)-6-methylpyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 143946761) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is (1R,2R,3R)-1-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-(1,3-benzothiazol-2-yl)-6-methylpyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2R,3R)-1-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-(1,3-benzothiazol-2-yl)-6-methylpyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 143946761 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (1R,2R,3R)-1-[[2-(1,3-benzodioxol-5-ylmethylamino)-5-(1,3-benzothiazol-2-yl)-6-methylpyrimidin-4-yl]amino]-3-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2ccc3c(c2)OCO3)nc(N[C@@]2(O)CC[C@H](CO)[C@H]2O)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C26H27N5O5S/c1-14-21(24-29-17-4-2-3-5-20(17)37-24)23(31-26(34)9-8-16(12-32)22(26)33)30-25(28-14)27-11-15-6-7-18-19(10-15)36-13-35-18/h2-7,10,16,22,32-34H,8-9,11-13H2,1H3,(H2,27,28,30,31)/t16-,22-,26-/m1/s1 |
| InChIKey | XNQPQDWQGAZRBW-DPJCOKGPSA-N |
| XLogP | 3.27 |
| TPSA | 141.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|