C24H29F3N6O4S2 — CID 123703068
[[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl-ethylamino]-methylidene-oxo-λ6-sulfanyl]formaldehyde (PubChem CID 123703068) has the molecular formula C24H29F3N6O4S2 and a molecular weight of 586.66 g/mol. Its IUPAC name is [[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl-ethylamino]-methylidene-oxo-λ6-sulfanyl]formaldehyde.
| Compound Name | [[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl-ethylamino]-methylidene-oxo-λ6-sulfanyl]formaldehyde |
|---|---|
| PubChem CID | 123703068 |
| Molecular Formula | C24H29F3N6O4S2 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.16 |
| IUPAC Name | [[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl-ethylamino]-methylidene-oxo-λ6-sulfanyl]formaldehyde |
| SMILES | C=S(=O)(C=O)N(CC)CC1CCC(O)(Nc2nc(NCC(F)(F)F)nc(C)c2-c2nc3ccccc3s2)C1O |
| InChI | InChI=1S/C24H29F3N6O4S2/c1-4-33(39(3,37)13-34)11-15-9-10-23(36,19(15)35)32-20-18(21-30-16-7-5-6-8-17(16)38-21)14(2)29-22(31-20)28-12-24(25,26)27/h5-8,13,15,19,35-36H,3-4,9-12H2,1-2H3,(H2,28,29,31,32) |
| InChIKey | ZUMOIDVVPHDQRF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|