C23H27F3N6O4S2 — CID 123138390
N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentylidene]methyl]-N-ethylmethanesulfonamide (PubChem CID 123138390) has the molecular formula C23H27F3N6O4S2 and a molecular weight of 572.64 g/mol. Its IUPAC name is N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentylidene]methyl]-N-ethylmethanesulfonamide.
| Compound Name | N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentylidene]methyl]-N-ethylmethanesulfonamide |
|---|---|
| PubChem CID | 123138390 |
| Molecular Formula | C23H27F3N6O4S2 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | N-[[3-[[5-(1,3-benzothiazol-2-yl)-6-methyl-2-(2,2,2-trifluoroethylamino)pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentylidene]methyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(C=C1CCC(O)(Nc2nc(NCC(F)(F)F)nc(C)c2-c2nc3ccccc3s2)C1O)S(C)(=O)=O |
| InChI | InChI=1S/C23H27F3N6O4S2/c1-4-32(38(3,35)36)11-14-9-10-22(34,18(14)33)31-19-17(20-29-15-7-5-6-8-16(15)37-20)13(2)28-21(30-19)27-12-23(24,25)26/h5-8,11,18,33-34H,4,9-10,12H2,1-3H3,(H2,27,28,30,31) |
| InChIKey | VSSOFHDBOKZESW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|