C25H32F3N5O3 — CID 162587051
[(1S,2R,3S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol (PubChem CID 162587051) has the molecular formula C25H32F3N5O3 and a molecular weight of 507.56 g/mol. Its IUPAC name is [(1S,2R,3S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol.
| Compound Name | [(1S,2R,3S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
|---|---|
| PubChem CID | 162587051 |
| Molecular Formula | C25H32F3N5O3 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | [(1S,2R,3S)-3-[[2-(2-ethoxyethylamino)-6-methyl-5-[5-(trifluoromethyl)furo[2,3-c]pyridin-2-yl]pyrimidin-4-yl]amino]-2,3-dimethylcyclopentyl]methanol |
| SMILES | CCOCCNc1nc(C)c(-c2cc3cc(C(F)(F)F)ncc3o2)c(N[C@@]2(C)CC[C@H](CO)[C@H]2C)n1 |
| InChI | InChI=1S/C25H32F3N5O3/c1-5-35-9-8-29-23-31-15(3)21(22(32-23)33-24(4)7-6-16(13-34)14(24)2)18-10-17-11-20(25(26,27)28)30-12-19(17)36-18/h10-12,14,16,34H,5-9,13H2,1-4H3,(H2,29,31,32,33)/t14-,16-,24+/m1/s1 |
| InChIKey | YPLKVTVFNNCJSX-WDNXAPGXSA-N |
| XLogP | 5.27 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|