C22H24BrFN4O14 — CID 91116038
4-[[4-(4-bromo-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1-(trihydroxymethyl)piperidine-2,2,3,3,4,5,5,6,6-nonol (PubChem CID 91116038) has the molecular formula C22H24BrFN4O14 and a molecular weight of 667.35 g/mol. Its IUPAC name is 4-[[4-(4-bromo-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1-(trihydroxymethyl)piperidine-2,2,3,3,4,5,5,6,6-nonol.
| Compound Name | 4-[[4-(4-bromo-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1-(trihydroxymethyl)piperidine-2,2,3,3,4,5,5,6,6-nonol |
|---|---|
| PubChem CID | 91116038 |
| Molecular Formula | C22H24BrFN4O14 |
| Molecular Weight | 667.35 g/mol |
| Exact Mass | 666.05 |
| IUPAC Name | 4-[[4-(4-bromo-2-fluoroanilino)-6-methoxyquinazolin-7-yl]oxymethyl]-1-(trihydroxymethyl)piperidine-2,2,3,3,4,5,5,6,6-nonol |
| SMILES | COc1cc2c(Nc3ccc(Br)cc3F)ncnc2cc1OCC1(O)C(O)(O)C(O)(O)N(C(O)(O)O)C(O)(O)C1(O)O |
| InChI | InChI=1S/C22H24BrFN4O14/c1-41-14-5-10-13(25-8-26-16(10)27-12-3-2-9(23)4-11(12)24)6-15(14)42-7-17(29)18(30,31)20(34,35)28(22(38,39)40)21(36,37)19(17,32)33/h2-6,8,29-40H,7H2,1H3,(H,25,26,27) |
| InChIKey | FEPDXKHHNMDESQ-UHFFFAOYSA-N |
| XLogP | -4.06 |
| TPSA | 302.27 Ų |
| H-Bond Donors | 13 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.35 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 13 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|