C23H35N3O3 — CID 91116555
tert-butyl 2-ethyl-2,3-dihydroindole-1-carboxylate;2-isocyanato-N-methylcyclohexan-1-amine (PubChem CID 91116555) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl 2-ethyl-2,3-dihydroindole-1-carboxylate;2-isocyanato-N-methylcyclohexan-1-amine.
| Compound Name | tert-butyl 2-ethyl-2,3-dihydroindole-1-carboxylate;2-isocyanato-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 91116555 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | tert-butyl 2-ethyl-2,3-dihydroindole-1-carboxylate;2-isocyanato-N-methylcyclohexan-1-amine |
| SMILES | CCC1Cc2ccccc2N1C(=O)OC(C)(C)C.CNC1CCCCC1N=C=O |
| InChI | InChI=1S/C15H21NO2.C8H14N2O/c1-5-12-10-11-8-6-7-9-13(11)16(12)14(17)18-15(2,3)4;1-9-7-4-2-3-5-8(7)10-6-11/h6-9,12H,5,10H2,1-4H3;7-9H,2-5H2,1H3 |
| InChIKey | QZUHSTWGNSDJMH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|