C21H23NO3 — CID 91117529
tert-butyl 2-(2,3-dihydro-1H-inden-2-ylcarbamoyl)benzoate (PubChem CID 91117529) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 2-(2,3-dihydro-1H-inden-2-ylcarbamoyl)benzoate.
| Compound Name | tert-butyl 2-(2,3-dihydro-1H-inden-2-ylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 91117529 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl 2-(2,3-dihydro-1H-inden-2-ylcarbamoyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccccc1C(=O)NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H23NO3/c1-21(2,3)25-20(24)18-11-7-6-10-17(18)19(23)22-16-12-14-8-4-5-9-15(14)13-16/h4-11,16H,12-13H2,1-3H3,(H,22,23) |
| InChIKey | DKYGBOXHKRWKSO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |