C10H16N2O3S2 — CID 91120586
tert-butyl N-[2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl]carbamate (PubChem CID 91120586) has the molecular formula C10H16N2O3S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl N-[2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 91120586 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | tert-butyl N-[2-(4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1c(O)csc1=S |
| InChI | InChI=1S/C10H16N2O3S2/c1-10(2,3)15-8(14)11-4-5-12-7(13)6-17-9(12)16/h6,13H,4-5H2,1-3H3,(H,11,14) |
| InChIKey | UQHKTZQSXDHLDT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|