C24H37FO5S — CID 91121402
methyl 7-[2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]octanoate (PubChem CID 91121402) has the molecular formula C24H37FO5S and a molecular weight of 456.62 g/mol. Its IUPAC name is methyl 7-[2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]octanoate.
| Compound Name | methyl 7-[2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]octanoate |
|---|---|
| PubChem CID | 91121402 |
| Molecular Formula | C24H37FO5S |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methyl 7-[2-[4-(2-fluorophenyl)sulfanyl-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]octanoate |
| SMILES | COC(=O)CCCCCC(C)C1C(O)CC(O)C1CCC(O)CSc1ccccc1F |
| InChI | InChI=1S/C24H37FO5S/c1-16(8-4-3-5-11-23(29)30-2)24-18(20(27)14-21(24)28)13-12-17(26)15-31-22-10-7-6-9-19(22)25/h6-7,9-10,16-18,20-21,24,26-28H,3-5,8,11-15H2,1-2H3 |
| InChIKey | CHNHVILSMXFSFJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|