C14H17NO5 — CID 91122601
(2S,3R,4S,5R)-2-(1H-indol-3-ylmethyl)oxane-2,3,4,5-tetrol (PubChem CID 91122601) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(1H-indol-3-ylmethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5R)-2-(1H-indol-3-ylmethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 91122601 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2S,3R,4S,5R)-2-(1H-indol-3-ylmethyl)oxane-2,3,4,5-tetrol |
| SMILES | O[C@H]1[C@H](O)CO[C@@](O)(Cc2c[nH]c3ccccc23)[C@@H]1O |
| InChI | InChI=1S/C14H17NO5/c16-11-7-20-14(19,13(18)12(11)17)5-8-6-15-10-4-2-1-3-9(8)10/h1-4,6,11-13,15-19H,5,7H2/t11-,12+,13-,14+/m1/s1 |
| InChIKey | HMLSLJUUAUCSRK-RQJABVFESA-N |
| XLogP | -0.49 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |