C30H41N5O7 — CID 91122609
9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-10-hydroxy-12a-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91122609) has the molecular formula C30H41N5O7 and a molecular weight of 583.69 g/mol. Its IUPAC name is 9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-10-hydroxy-12a-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-10-hydroxy-12a-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91122609 |
| Molecular Formula | C30H41N5O7 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | 9-[[2-(tert-butylamino)acetyl]amino]-4,7-bis(dimethylamino)-10-hydroxy-12a-methyl-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)CNC(C)(C)C)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(C)C(=O)C1C2=O |
| InChI | InChI=1S/C30H41N5O7/c1-29(2,3)32-12-18(36)33-16-11-17(34(5)6)14-9-13-10-15-22(35(7)8)25(39)21(28(31)42)27(41)30(15,4)26(40)19(13)24(38)20(14)23(16)37/h11,13,15,19,21-22,32,37H,9-10,12H2,1-8H3,(H2,31,42)(H,33,36) |
| InChIKey | FEXOFEITOPKMPQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|