C12H23N3 — CID 91124842
[6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide;ethane (PubChem CID 91124842) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide;ethane.
| Compound Name | [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide;ethane |
|---|---|
| PubChem CID | 91124842 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide;ethane |
| SMILES | C=[N+](C)[N-]C1=CCCC=C1N(C)C.CC |
| InChI | InChI=1S/C10H17N3.C2H6/c1-12(2)10-8-6-5-7-9(10)11-13(3)4;1-2/h7-8H,3,5-6H2,1-2,4H3;1-2H3 |
| InChIKey | GGSXPFDHEAQZJG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|