C10H17N3 — CID 91124843
[6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide (PubChem CID 91124843) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide.
| Compound Name | [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide |
|---|---|
| PubChem CID | 91124843 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | [6-(dimethylamino)cyclohexa-1,5-dien-1-yl]-[methyl(methylidene)azaniumyl]azanide |
| SMILES | C=[N+](C)[N-]C1=CCCC=C1N(C)C |
| InChI | InChI=1S/C10H17N3/c1-12(2)10-8-6-5-7-9(10)11-13(3)4/h7-8H,3,5-6H2,1-2,4H3 |
| InChIKey | JLSZIYCCCGCHFH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 20.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|