C15H19IN2O2 — CID 91126412
[3-(2-iodophenoxy)pyrrolidin-1-yl]-pyrrolidin-1-ylmethanone (PubChem CID 91126412) has the molecular formula C15H19IN2O2 and a molecular weight of 386.23 g/mol. Its IUPAC name is [3-(2-iodophenoxy)pyrrolidin-1-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-(2-iodophenoxy)pyrrolidin-1-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 91126412 |
| Molecular Formula | C15H19IN2O2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [3-(2-iodophenoxy)pyrrolidin-1-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCC(Oc2ccccc2I)C1 |
| InChI | InChI=1S/C15H19IN2O2/c16-13-5-1-2-6-14(13)20-12-7-10-18(11-12)15(19)17-8-3-4-9-17/h1-2,5-6,12H,3-4,7-11H2 |
| InChIKey | NKBWXPGEWSXPOU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|