C14H11ClN2S — CID 91127273
2-[(4-chloro-2-thiophen-2-ylphenyl)methyl]-1H-imidazole (PubChem CID 91127273) has the molecular formula C14H11ClN2S and a molecular weight of 274.78 g/mol. Its IUPAC name is 2-[(4-chloro-2-thiophen-2-ylphenyl)methyl]-1H-imidazole.
| Compound Name | 2-[(4-chloro-2-thiophen-2-ylphenyl)methyl]-1H-imidazole |
|---|---|
| PubChem CID | 91127273 |
| Molecular Formula | C14H11ClN2S |
| Molecular Weight | 274.78 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-[(4-chloro-2-thiophen-2-ylphenyl)methyl]-1H-imidazole |
| SMILES | Clc1ccc(Cc2ncc[nH]2)c(-c2cccs2)c1 |
| InChI | InChI=1S/C14H11ClN2S/c15-11-4-3-10(8-14-16-5-6-17-14)12(9-11)13-2-1-7-18-13/h1-7,9H,8H2,(H,16,17) |
| InChIKey | TYBIQYKLAQDZEC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |