C6H9BrN2O4S3 — CID 91128885
1-(5-bromothiophen-2-yl)-N-(sulfamoylmethyl)methanesulfonamide (PubChem CID 91128885) has the molecular formula C6H9BrN2O4S3 and a molecular weight of 349.25 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-N-(sulfamoylmethyl)methanesulfonamide.
| Compound Name | 1-(5-bromothiophen-2-yl)-N-(sulfamoylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 91128885 |
| Molecular Formula | C6H9BrN2O4S3 |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 347.89 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-N-(sulfamoylmethyl)methanesulfonamide |
| SMILES | NS(=O)(=O)CNS(=O)(=O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C6H9BrN2O4S3/c7-6-2-1-5(14-6)3-16(12,13)9-4-15(8,10)11/h1-2,9H,3-4H2,(H2,8,10,11) |
| InChIKey | FWJXDQZDYPBQHP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |