C8H10BrNO3S2 — CID 94216030
(2R)-2-[(5-bromothiophen-2-yl)methylsulfonyl]propanamide (PubChem CID 94216030) has the molecular formula C8H10BrNO3S2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (2R)-2-[(5-bromothiophen-2-yl)methylsulfonyl]propanamide.
| Compound Name | (2R)-2-[(5-bromothiophen-2-yl)methylsulfonyl]propanamide |
|---|---|
| PubChem CID | 94216030 |
| Molecular Formula | C8H10BrNO3S2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | (2R)-2-[(5-bromothiophen-2-yl)methylsulfonyl]propanamide |
| SMILES | C[C@H](C(N)=O)S(=O)(=O)Cc1ccc(Br)s1 |
| InChI | InChI=1S/C8H10BrNO3S2/c1-5(8(10)11)15(12,13)4-6-2-3-7(9)14-6/h2-3,5H,4H2,1H3,(H2,10,11)/t5-/m1/s1 |
| InChIKey | PYJUUDMSMNPYDZ-RXMQYKEDSA-N |
| XLogP | 1.30 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |