C8H11N3O3 — CID 91129259
2-(2,5-dioxopyrrol-1-yl)-N-(methylaminomethyl)acetamide (PubChem CID 91129259) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)-N-(methylaminomethyl)acetamide.
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)-N-(methylaminomethyl)acetamide |
|---|---|
| PubChem CID | 91129259 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)-N-(methylaminomethyl)acetamide |
| SMILES | CNCNC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C8H11N3O3/c1-9-5-10-6(12)4-11-7(13)2-3-8(11)14/h2-3,9H,4-5H2,1H3,(H,10,12) |
| InChIKey | GLBJSCAPVHHKOS-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|