C10H19NO3 — CID 158929127
methane;1-(2-oxopropyl)pyrrole-2,5-dione (PubChem CID 158929127) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is methane;1-(2-oxopropyl)pyrrole-2,5-dione.
| Compound Name | methane;1-(2-oxopropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 158929127 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methane;1-(2-oxopropyl)pyrrole-2,5-dione |
| SMILES | C.C.C.CC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO3.3CH4/c1-5(9)4-8-6(10)2-3-7(8)11;;;/h2-3H,4H2,1H3;3*1H4 |
| InChIKey | JIUZODUJQCPHME-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|