About methane;1-(2-oxopropyl)pyrrole-2,5-dione
methane;1-(2-oxopropyl)pyrrole-2,5-dione (PubChem CID 158929127) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is methane;1-(2-oxopropyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | methane;1-(2-oxopropyl)pyrrole-2,5-dione |
| PubChem CID | 158929127 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | methane;1-(2-oxopropyl)pyrrole-2,5-dione |
| SMILES | C.C.C.CC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H7NO3.3CH4/c1-5(9)4-8-6(10)2-3-7(8)11;;;/h2-3H,4H2,1H3;3*1H4 |
| InChIKey | JIUZODUJQCPHME-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methane;1-(2-oxopropyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(2-oxopropyl)pyrrole-2,5-dione?
The IUPAC name of methane;1-(2-oxopropyl)pyrrole-2,5-dione (CID 158929127) is methane;1-(2-oxopropyl)pyrrole-2,5-dione.
What is the SMILES notation for methane;1-(2-oxopropyl)pyrrole-2,5-dione?
The canonical SMILES for methane;1-(2-oxopropyl)pyrrole-2,5-dione is C.C.C.CC(=O)CN1C(=O)C=CC1=O.
What is the InChIKey of methane;1-(2-oxopropyl)pyrrole-2,5-dione?
The InChIKey is JIUZODUJQCPHME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.3CH4/c1-5(9)4-8-6(10)2-3-7(8)11;;;/h2-3H,4H2,1H3;3*1H4.
What are the key properties of methane;1-(2-oxopropyl)pyrrole-2,5-dione?
methane;1-(2-oxopropyl)pyrrole-2,5-dione has a molecular weight of 201.27 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(2-oxopropyl)pyrrole-2,5-dione is sourced from PubChem (CID 158929127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).