C48H15NO3 — CID 167698604
1-(3-oxobutyl)pyrrole-2,5-dione;tetraconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38-nonadecayne (PubChem CID 167698604) has the molecular formula C48H15NO3 and a molecular weight of 653.65 g/mol. Its IUPAC name is 1-(3-oxobutyl)pyrrole-2,5-dione;tetraconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38-nonadecayne.
| Compound Name | 1-(3-oxobutyl)pyrrole-2,5-dione;tetraconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38-nonadecayne |
|---|---|
| PubChem CID | 167698604 |
| Molecular Formula | C48H15NO3 |
| Molecular Weight | 653.65 g/mol |
| Exact Mass | 653.11 |
| IUPAC Name | 1-(3-oxobutyl)pyrrole-2,5-dione;tetraconta-2,4,6,8,10,12,14,16,18,20,22,24,26,28,30,32,34,36,38-nonadecayne |
| SMILES | CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC#CC.CC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C40H6.C8H9NO3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;1-6(10)4-5-9-7(11)2-3-8(9)12/h1-2H3;2-3H,4-5H2,1H3 |
| InChIKey | YANCBSJUYTZNKR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.65 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|