C10H8N2O3 — CID 100953028
1-(2-oxo-2-pyrrol-1-ylethyl)pyrrole-2,5-dione (PubChem CID 100953028) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-(2-oxo-2-pyrrol-1-ylethyl)pyrrole-2,5-dione.
| Compound Name | 1-(2-oxo-2-pyrrol-1-ylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 100953028 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1-(2-oxo-2-pyrrol-1-ylethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC(=O)n1cccc1 |
| InChI | InChI=1S/C10H8N2O3/c13-8-3-4-9(14)12(8)7-10(15)11-5-1-2-6-11/h1-6H,7H2 |
| InChIKey | LBFJXNGUYXCVCD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|