C7H8N2O3 — CID 174707284
1-(3-amino-2-oxopropyl)pyrrole-2,5-dione (PubChem CID 174707284) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 1-(3-amino-2-oxopropyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-amino-2-oxopropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 174707284 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 1-(3-amino-2-oxopropyl)pyrrole-2,5-dione |
| SMILES | NCC(=O)CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O3/c8-3-5(10)4-9-6(11)1-2-7(9)12/h1-2H,3-4,8H2 |
| InChIKey | PNZGMVDODULGJC-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|