C23H19BrCl2N4O4S — CID 91130582
2-[[4-[acetamido-(2-bromoethylidene)-oxo-λ6-sulfanyl]benzoyl]amino]-5-chloro-N-(5-chloro-2-pyridinyl)benzamide (PubChem CID 91130582) has the molecular formula C23H19BrCl2N4O4S and a molecular weight of 598.31 g/mol. Its IUPAC name is 2-[[4-[acetamido-(2-bromoethylidene)-oxo-λ6-sulfanyl]benzoyl]amino]-5-chloro-N-(5-chloro-2-pyridinyl)benzamide.
| Compound Name | 2-[[4-[acetamido-(2-bromoethylidene)-oxo-λ6-sulfanyl]benzoyl]amino]-5-chloro-N-(5-chloro-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 91130582 |
| Molecular Formula | C23H19BrCl2N4O4S |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 595.97 |
| IUPAC Name | 2-[[4-[acetamido-(2-bromoethylidene)-oxo-λ6-sulfanyl]benzoyl]amino]-5-chloro-N-(5-chloro-2-pyridinyl)benzamide |
| SMILES | CC(=O)NS(=O)(=CCBr)c1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)cc1 |
| InChI | InChI=1S/C23H19BrCl2N4O4S/c1-14(31)30-35(34,11-10-24)18-6-2-15(3-7-18)22(32)28-20-8-4-16(25)12-19(20)23(33)29-21-9-5-17(26)13-27-21/h2-9,11-13H,10H2,1H3,(H,28,32)(H,27,29,33)(H,30,31,34) |
| InChIKey | SJHAOQWEHAPVQI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|