C18H40OSi — CID 91130970
4-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]-2,2,4-trimethylpentan-1-ol (PubChem CID 91130970) has the molecular formula C18H40OSi and a molecular weight of 300.60 g/mol. Its IUPAC name is 4-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]-2,2,4-trimethylpentan-1-ol.
| Compound Name | 4-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]-2,2,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 91130970 |
| Molecular Formula | C18H40OSi |
| Molecular Weight | 300.60 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | 4-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]-2,2,4-trimethylpentan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)[Si](C)(C)C(C)(C)CC(C)(C)CO |
| InChI | InChI=1S/C18H40OSi/c1-15(2,3)12-17(6,7)20(10,11)18(8,9)13-16(4,5)14-19/h19H,12-14H2,1-11H3 |
| InChIKey | LWBPZEJSPTXITD-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|