C13H18O6S2 — CID 91131682
3-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-disulfonic acid (PubChem CID 91131682) has the molecular formula C13H18O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-disulfonic acid.
| Compound Name | 3-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 91131682 |
| Molecular Formula | C13H18O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 3-propan-2-yl-1,2,3,4-tetrahydronaphthalene-1,2-disulfonic acid |
| SMILES | CC(C)C1Cc2ccccc2C(S(=O)(=O)O)C1S(=O)(=O)O |
| InChI | InChI=1S/C13H18O6S2/c1-8(2)11-7-9-5-3-4-6-10(9)12(20(14,15)16)13(11)21(17,18)19/h3-6,8,11-13H,7H2,1-2H3,(H,14,15,16)(H,17,18,19) |
| InChIKey | FZEMNAAXLQXTCH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|