C13H14N2O4S — CID 91131848
8-methyl-5,7-dioxo-6-pent-2-enyl-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid (PubChem CID 91131848) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 8-methyl-5,7-dioxo-6-pent-2-enyl-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid.
| Compound Name | 8-methyl-5,7-dioxo-6-pent-2-enyl-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91131848 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 8-methyl-5,7-dioxo-6-pent-2-enyl-[1,3]thiazolo[3,2-c]pyrimidine-2-carboxylic acid |
| SMILES | CCC=CCn1c(=O)c(C)c2sc(C(=O)O)cn2c1=O |
| InChI | InChI=1S/C13H14N2O4S/c1-3-4-5-6-14-10(16)8(2)11-15(13(14)19)7-9(20-11)12(17)18/h4-5,7H,3,6H2,1-2H3,(H,17,18) |
| InChIKey | QMWYDZQWTWRHQW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|