C25H31F3N8O2 — CID 91133110
5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-[(dimethylamino)methyl]-4-methoxy-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide (PubChem CID 91133110) has the molecular formula C25H31F3N8O2 and a molecular weight of 532.57 g/mol. Its IUPAC name is 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-[(dimethylamino)methyl]-4-methoxy-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-[(dimethylamino)methyl]-4-methoxy-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91133110 |
| Molecular Formula | C25H31F3N8O2 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-[(dimethylamino)methyl]-4-methoxy-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(/CN(N)c1cc(C(=O)Nc2cc(CN(C)C)c(OC)c(C(F)(F)F)c2)cnc1C)c1cnn(C)c1C |
| InChI | InChI=1S/C25H31F3N8O2/c1-14-22(36(30)13-21(29)19-11-32-35(5)15(19)2)8-16(10-31-14)24(37)33-18-7-17(12-34(3)4)23(38-6)20(9-18)25(26,27)28/h7-11,29H,12-13,30H2,1-6H3,(H,33,37)/b29-21- |
| InChIKey | WXCFFWRSPGAEKN-ANYBSYGZSA-N |
| XLogP | 3.52 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|