C28H36FN9O2 — CID 91409938
N-[5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-6-methyl-3-pyridinyl]-3-(4-ethylpiperazin-1-yl)-5-(1-fluoroethenoxy)benzamide (PubChem CID 91409938) has the molecular formula C28H36FN9O2 and a molecular weight of 549.66 g/mol. Its IUPAC name is N-[5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-6-methyl-3-pyridinyl]-3-(4-ethylpiperazin-1-yl)-5-(1-fluoroethenoxy)benzamide.
| Compound Name | N-[5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-6-methyl-3-pyridinyl]-3-(4-ethylpiperazin-1-yl)-5-(1-fluoroethenoxy)benzamide |
|---|---|
| PubChem CID | 91409938 |
| Molecular Formula | C28H36FN9O2 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | N-[5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-6-methyl-3-pyridinyl]-3-(4-ethylpiperazin-1-yl)-5-(1-fluoroethenoxy)benzamide |
| SMILES | [H]/N=C(/CN(N)c1cc(NC(=O)c2cc(OC(=C)F)cc(N3CCN(CC)CC3)c2)cnc1C)c1cnn(C)c1C |
| InChI | InChI=1S/C28H36FN9O2/c1-6-36-7-9-37(10-8-36)23-11-21(12-24(14-23)40-20(4)29)28(39)34-22-13-27(18(2)32-15-22)38(31)17-26(30)25-16-33-35(5)19(25)3/h11-16,30H,4,6-10,17,31H2,1-3,5H3,(H,34,39)/b30-26- |
| InChIKey | MRZHRSRGMXNSEK-BXVZCJGGSA-N |
| XLogP | 3.39 |
| TPSA | 128.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|