C27H32FN9O3S — CID 136650981
N-[5-[[2-(2-acetamido-1,3-thiazol-5-yl)-2-iminoethyl]-aminoamino]-6-methyl-3-pyridinyl]-3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)benzamide (PubChem CID 136650981) has the molecular formula C27H32FN9O3S and a molecular weight of 581.68 g/mol. Its IUPAC name is N-[5-[[2-(2-acetamido-1,3-thiazol-5-yl)-2-iminoethyl]-aminoamino]-6-methyl-3-pyridinyl]-3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[[2-(2-acetamido-1,3-thiazol-5-yl)-2-iminoethyl]-aminoamino]-6-methyl-3-pyridinyl]-3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 136650981 |
| Molecular Formula | C27H32FN9O3S |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | N-[5-[[2-(2-acetamido-1,3-thiazol-5-yl)-2-iminoethyl]-aminoamino]-6-methyl-3-pyridinyl]-3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)benzamide |
| SMILES | [H]/N=C(/CN(N)c1cc(NC(=O)c2cc(OC(=C)F)cc(N3CCN(C)CC3)c2)cnc1C)c1cnc(NC(C)=O)s1 |
| InChI | InChI=1S/C27H32FN9O3S/c1-16-24(37(30)15-23(29)25-14-32-27(41-25)33-18(3)38)11-20(13-31-16)34-26(39)19-9-21(12-22(10-19)40-17(2)28)36-7-5-35(4)6-8-36/h9-14,29H,2,5-8,15,30H2,1,3-4H3,(H,34,39)(H,32,33,38)/b29-23- |
| InChIKey | HCNRCGCOQXJVDS-FAJYDZGRSA-N |
| XLogP | 3.38 |
| TPSA | 152.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|