C22H28N6O2S — CID 143628391
N-[5-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-methyl-3-pyridinyl]-3-methyl-5-thiomorpholin-4-ylbenzamide (PubChem CID 143628391) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is N-[5-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-methyl-3-pyridinyl]-3-methyl-5-thiomorpholin-4-ylbenzamide.
| Compound Name | N-[5-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-methyl-3-pyridinyl]-3-methyl-5-thiomorpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 143628391 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[5-[amino-[(Z)-2-amino-3-oxobut-1-enyl]amino]-6-methyl-3-pyridinyl]-3-methyl-5-thiomorpholin-4-ylbenzamide |
| SMILES | CC(=O)/C(N)=C/N(N)c1cc(NC(=O)c2cc(C)cc(N3CCSCC3)c2)cnc1C |
| InChI | InChI=1S/C22H28N6O2S/c1-14-8-17(10-19(9-14)27-4-6-31-7-5-27)22(30)26-18-11-21(15(2)25-12-18)28(24)13-20(23)16(3)29/h8-13H,4-7,23-24H2,1-3H3,(H,26,30)/b20-13- |
| InChIKey | GHOUKUFLZVPLPM-MOSHPQCFSA-N |
| XLogP | 2.57 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|