C27H41F2N6O3P — CID 143628397
(Z)-3-amino-4-[amino-[5-[3-[difluoro(phosphanyl)methyl]-5-morpholin-4-ylphenyl]-2-methyl-3-pyridinyl]amino]but-3-en-2-one;2,2-dimethylpropane;formamide (PubChem CID 143628397) has the molecular formula C27H41F2N6O3P and a molecular weight of 566.63 g/mol. Its IUPAC name is (Z)-3-amino-4-[amino-[5-[3-[difluoro(phosphanyl)methyl]-5-morpholin-4-ylphenyl]-2-methyl-3-pyridinyl]amino]but-3-en-2-one;2,2-dimethylpropane;formamide.
| Compound Name | (Z)-3-amino-4-[amino-[5-[3-[difluoro(phosphanyl)methyl]-5-morpholin-4-ylphenyl]-2-methyl-3-pyridinyl]amino]but-3-en-2-one;2,2-dimethylpropane;formamide |
|---|---|
| PubChem CID | 143628397 |
| Molecular Formula | C27H41F2N6O3P |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | (Z)-3-amino-4-[amino-[5-[3-[difluoro(phosphanyl)methyl]-5-morpholin-4-ylphenyl]-2-methyl-3-pyridinyl]amino]but-3-en-2-one;2,2-dimethylpropane;formamide |
| SMILES | CC(=O)/C(N)=C/N(N)c1cc(-c2cc(N3CCOCC3)cc(C(F)(F)P)c2)cnc1C.CC(C)(C)C.NC=O |
| InChI | InChI=1S/C21H26F2N5O2P.C5H12.CH3NO/c1-13-20(28(25)12-19(24)14(2)29)9-16(11-26-13)15-7-17(21(22,23)31)10-18(8-15)27-3-5-30-6-4-27;1-5(2,3)4;2-1-3/h7-12H,3-6,24-25,31H2,1-2H3;1-4H3;1H,(H2,2,3)/b19-12-;; |
| InChIKey | HIAMPKXEPDYFTJ-STAIPAPMSA-N |
| XLogP | 4.04 |
| TPSA | 140.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|