C22H23BrF3N7O — CID 90690762
5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-bromo-2-methyl-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide (PubChem CID 90690762) has the molecular formula C22H23BrF3N7O and a molecular weight of 538.37 g/mol. Its IUPAC name is 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-bromo-2-methyl-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-bromo-2-methyl-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 90690762 |
| Molecular Formula | C22H23BrF3N7O |
| Molecular Weight | 538.37 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[3-bromo-2-methyl-5-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(/CN(N)c1cc(C(=O)Nc2cc(C(F)(F)F)cc(Br)c2C)cnc1C)c1cnn(C)c1C |
| InChI | InChI=1S/C22H23BrF3N7O/c1-11-17(23)6-15(22(24,25)26)7-19(11)31-21(34)14-5-20(12(2)29-8-14)33(28)10-18(27)16-9-30-32(4)13(16)3/h5-9,27H,10,28H2,1-4H3,(H,31,34)/b27-18- |
| InChIKey | FZIPNHVNCXCMQU-IMRQLAEWSA-N |
| XLogP | 4.52 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|