C29H36F3N9O — CID 90987731
N-[5-[amino-[2-imino-2-[5-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 90987731) has the molecular formula C29H36F3N9O and a molecular weight of 583.66 g/mol. Its IUPAC name is N-[5-[amino-[2-imino-2-[5-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[5-[amino-[2-imino-2-[5-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90987731 |
| Molecular Formula | C29H36F3N9O |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | N-[5-[amino-[2-imino-2-[5-(4-pentan-3-ylpiperazin-1-yl)-3-pyridinyl]ethyl]amino]-6-methyl-3-pyridinyl]-4-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C(/CN(N)c1cc(NC(=O)c2cc(C(F)(F)F)ccn2)cnc1C)c1cncc(N2CCN(C(CC)CC)CC2)c1 |
| InChI | InChI=1S/C29H36F3N9O/c1-4-23(5-2)39-8-10-40(11-9-39)24-12-20(15-35-17-24)25(33)18-41(34)27-14-22(16-37-19(27)3)38-28(42)26-13-21(6-7-36-26)29(30,31)32/h6-7,12-17,23,33H,4-5,8-11,18,34H2,1-3H3,(H,38,42)/b33-25- |
| InChIKey | DVNIYCKDTPZQPC-IVQJCJPDSA-N |
| XLogP | 4.51 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|