C28H33FN8O3 — CID 91504782
5-[amino-[2-imino-2-(5-methoxy-3-pyridinyl)ethyl]amino]-N-[3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)phenyl]-6-methylpyridine-3-carboxamide (PubChem CID 91504782) has the molecular formula C28H33FN8O3 and a molecular weight of 548.62 g/mol. Its IUPAC name is 5-[amino-[2-imino-2-(5-methoxy-3-pyridinyl)ethyl]amino]-N-[3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)phenyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 5-[amino-[2-imino-2-(5-methoxy-3-pyridinyl)ethyl]amino]-N-[3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)phenyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91504782 |
| Molecular Formula | C28H33FN8O3 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 5-[amino-[2-imino-2-(5-methoxy-3-pyridinyl)ethyl]amino]-N-[3-(1-fluoroethenoxy)-5-(4-methylpiperazin-1-yl)phenyl]-6-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(/CN(N)c1cc(C(=O)Nc2cc(OC(=C)F)cc(N3CCN(C)CC3)c2)cnc1C)c1cncc(OC)c1 |
| InChI | InChI=1S/C28H33FN8O3/c1-18-27(37(31)17-26(30)20-9-25(39-4)16-32-14-20)10-21(15-33-18)28(38)34-22-11-23(13-24(12-22)40-19(2)29)36-7-5-35(3)6-8-36/h9-16,30H,2,5-8,17,31H2,1,3-4H3,(H,34,38)/b30-26- |
| InChIKey | YMNXSAYJKAVESM-BXVZCJGGSA-N |
| XLogP | 3.37 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|