C23H29BrN2O — CID 91134958
(NZ)-N-[1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]ethylidene]hydroxylamine (PubChem CID 91134958) has the molecular formula C23H29BrN2O and a molecular weight of 429.40 g/mol. Its IUPAC name is (NZ)-N-[1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 91134958 |
| Molecular Formula | C23H29BrN2O |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (NZ)-N-[1-[3-[2-[4-[(2-bromo-5-methylphenyl)methyl]piperidin-1-yl]ethyl]phenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1cccc(CCN2CCC(Cc3cc(C)ccc3Br)CC2)c1 |
| InChI | InChI=1S/C23H29BrN2O/c1-17-6-7-23(24)22(14-17)16-20-9-12-26(13-10-20)11-8-19-4-3-5-21(15-19)18(2)25-27/h3-7,14-15,20,27H,8-13,16H2,1-2H3/b25-18- |
| InChIKey | JZDDPXLHAFJOOI-BWAHOGKJSA-N |
| XLogP | 5.45 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|