C26H32O — CID 91136542
1-anthracen-9-yl-3-tert-butyl-3,5-dimethylhexan-2-one (PubChem CID 91136542) has the molecular formula C26H32O and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-anthracen-9-yl-3-tert-butyl-3,5-dimethylhexan-2-one.
| Compound Name | 1-anthracen-9-yl-3-tert-butyl-3,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 91136542 |
| Molecular Formula | C26H32O |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-anthracen-9-yl-3-tert-butyl-3,5-dimethylhexan-2-one |
| SMILES | CC(C)CC(C)(C(=O)Cc1c2ccccc2cc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C26H32O/c1-18(2)17-26(6,25(3,4)5)24(27)16-23-21-13-9-7-11-19(21)15-20-12-8-10-14-22(20)23/h7-15,18H,16-17H2,1-6H3 |
| InChIKey | FVVBNFVASDARMQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|