C18H25NaO3S — CID 174299433
sodium;1,3-bis(2-methylpropyl)naphthalene-2-sulfonic acid;hydride (PubChem CID 174299433) has the molecular formula C18H25NaO3S and a molecular weight of 344.45 g/mol. Its IUPAC name is sodium;1,3-bis(2-methylpropyl)naphthalene-2-sulfonic acid;hydride.
| Compound Name | sodium;1,3-bis(2-methylpropyl)naphthalene-2-sulfonic acid;hydride |
|---|---|
| PubChem CID | 174299433 |
| Molecular Formula | C18H25NaO3S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | sodium;1,3-bis(2-methylpropyl)naphthalene-2-sulfonic acid;hydride |
| SMILES | CC(C)Cc1cc2ccccc2c(CC(C)C)c1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C18H24O3S.Na.H/c1-12(2)9-15-11-14-7-5-6-8-16(14)17(10-13(3)4)18(15)22(19,20)21;;/h5-8,11-13H,9-10H2,1-4H3,(H,19,20,21);;/q;+1;-1 |
| InChIKey | DAOCPVYIFHBZCV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|