1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid

C18H25ClO3S — CID 163475052

IUPAC1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid
SMILESCC(C)Cc1ccc2ccccc2c1CC(C)C.O=S(=O)(O)Cl
InChIInChI=1S/C18H24.ClHO3S/c1-13(2)11-16-10-9-15-7-5-6-8-17(15)18(16)12-14(3)4;1-5(2,3)4/h5-10,13-14H,11-12H2,1-4H3;(H,2,3,4)
InChIKeyBZSYXYPLCUCAFJ-UHFFFAOYSA-N
MW356.92 g/mol
LogP5.26
Rot. Bonds4

About 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid

1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid (PubChem CID 163475052) has the molecular formula C18H25ClO3S and a molecular weight of 356.92 g/mol. Its IUPAC name is 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid.

Molecular Properties

Compound Name1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid
PubChem CID163475052
Molecular FormulaC18H25ClO3S
Molecular Weight356.92 g/mol
Exact Mass356.12
IUPAC Name1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid
SMILESCC(C)Cc1ccc2ccccc2c1CC(C)C.O=S(=O)(O)Cl
InChIInChI=1S/C18H24.ClHO3S/c1-13(2)11-16-10-9-15-7-5-6-8-17(15)18(16)12-14(3)4;1-5(2,3)4/h5-10,13-14H,11-12H2,1-4H3;(H,2,3,4)
InChIKeyBZSYXYPLCUCAFJ-UHFFFAOYSA-N
XLogP5.26
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.92
LogP ≤ 55.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid?
The IUPAC name of 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid (CID 163475052) is 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid.
What is the SMILES notation for 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid?
The canonical SMILES for 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid is CC(C)Cc1ccc2ccccc2c1CC(C)C.O=S(=O)(O)Cl.
What is the InChIKey of 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid?
The InChIKey is BZSYXYPLCUCAFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24.ClHO3S/c1-13(2)11-16-10-9-15-7-5-6-8-17(15)18(16)12-14(3)4;1-5(2,3)4/h5-10,13-14H,11-12H2,1-4H3;(H,2,3,4).
What are the key properties of 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid?
1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid has a molecular weight of 356.92 g/mol, XLogP of 5.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid is sourced from PubChem (CID 163475052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).