C18H25ClO3S — CID 163475052
1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid (PubChem CID 163475052) has the molecular formula C18H25ClO3S and a molecular weight of 356.92 g/mol. Its IUPAC name is 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid.
| Compound Name | 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid |
|---|---|
| PubChem CID | 163475052 |
| Molecular Formula | C18H25ClO3S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1,2-bis(2-methylpropyl)naphthalene;sulfurochloridic acid |
| SMILES | CC(C)Cc1ccc2ccccc2c1CC(C)C.O=S(=O)(O)Cl |
| InChI | InChI=1S/C18H24.ClHO3S/c1-13(2)11-16-10-9-15-7-5-6-8-17(15)18(16)12-14(3)4;1-5(2,3)4/h5-10,13-14H,11-12H2,1-4H3;(H,2,3,4) |
| InChIKey | BZSYXYPLCUCAFJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|