C12H14O7S2 — CID 166064119
[1-(sulfomethyl)naphthalen-2-yl]methanesulfonic acid;hydrate (PubChem CID 166064119) has the molecular formula C12H14O7S2 and a molecular weight of 334.37 g/mol. Its IUPAC name is [1-(sulfomethyl)naphthalen-2-yl]methanesulfonic acid;hydrate.
| Compound Name | [1-(sulfomethyl)naphthalen-2-yl]methanesulfonic acid;hydrate |
|---|---|
| PubChem CID | 166064119 |
| Molecular Formula | C12H14O7S2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | [1-(sulfomethyl)naphthalen-2-yl]methanesulfonic acid;hydrate |
| SMILES | O.O=S(=O)(O)Cc1ccc2ccccc2c1CS(=O)(=O)O |
| InChI | InChI=1S/C12H12O6S2.H2O/c13-19(14,15)7-10-6-5-9-3-1-2-4-11(9)12(10)8-20(16,17)18;/h1-6H,7-8H2,(H,13,14,15)(H,16,17,18);1H2 |
| InChIKey | LHYCRNLCICUJLE-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|