C15H24O4S — CID 158148866
[4-hydroxy-2,3-bis(2-methylpropyl)phenyl]methanesulfonic acid (PubChem CID 158148866) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is [4-hydroxy-2,3-bis(2-methylpropyl)phenyl]methanesulfonic acid.
| Compound Name | [4-hydroxy-2,3-bis(2-methylpropyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 158148866 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | [4-hydroxy-2,3-bis(2-methylpropyl)phenyl]methanesulfonic acid |
| SMILES | CC(C)Cc1c(O)ccc(CS(=O)(=O)O)c1CC(C)C |
| InChI | InChI=1S/C15H24O4S/c1-10(2)7-13-12(9-20(17,18)19)5-6-15(16)14(13)8-11(3)4/h5-6,10-11,16H,7-9H2,1-4H3,(H,17,18,19) |
| InChIKey | ZKEZXSRWIISGHJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|