C15H13N3O3 — CID 91137828
[2-methoxy-5-(5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] acetate (PubChem CID 91137828) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is [2-methoxy-5-(5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] acetate.
| Compound Name | [2-methoxy-5-(5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] acetate |
|---|---|
| PubChem CID | 91137828 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [2-methoxy-5-(5H-pyrrolo[2,3-b]pyrazin-6-yl)phenyl] acetate |
| SMILES | COc1ccc(-c2cc3nccnc3[nH]2)cc1OC(C)=O |
| InChI | InChI=1S/C15H13N3O3/c1-9(19)21-14-7-10(3-4-13(14)20-2)11-8-12-15(18-11)17-6-5-16-12/h3-8H,1-2H3,(H,17,18) |
| InChIKey | BLWMOIZOQWHDHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|