C18H28N2O2 — CID 91138223
4-methyl-1-[3-[4-(1-nitrosopropyl)phenoxy]propyl]piperidine (PubChem CID 91138223) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-methyl-1-[3-[4-(1-nitrosopropyl)phenoxy]propyl]piperidine.
| Compound Name | 4-methyl-1-[3-[4-(1-nitrosopropyl)phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 91138223 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-methyl-1-[3-[4-(1-nitrosopropyl)phenoxy]propyl]piperidine |
| SMILES | CCC(N=O)c1ccc(OCCCN2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-3-18(19-21)16-5-7-17(8-6-16)22-14-4-11-20-12-9-15(2)10-13-20/h5-8,15,18H,3-4,9-14H2,1-2H3 |
| InChIKey | ZPGMKMWAZNLZRI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|