C24H22F3N2+ — CID 91140863
6-(3-ethylphenyl)-5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[1,2-a]pyrazin-5-ium (PubChem CID 91140863) has the molecular formula C24H22F3N2+ and a molecular weight of 395.45 g/mol. Its IUPAC name is 6-(3-ethylphenyl)-5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[1,2-a]pyrazin-5-ium.
| Compound Name | 6-(3-ethylphenyl)-5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[1,2-a]pyrazin-5-ium |
|---|---|
| PubChem CID | 91140863 |
| Molecular Formula | C24H22F3N2+ |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 6-(3-ethylphenyl)-5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolo[1,2-a]pyrazin-5-ium |
| SMILES | CCc1cccc(C2=CC=C3C(Cc4cccc(C(F)(F)F)c4)=NC=C[N+]32C)c1 |
| InChI | InChI=1S/C24H22F3N2/c1-3-17-6-4-8-19(14-17)22-10-11-23-21(28-12-13-29(22,23)2)16-18-7-5-9-20(15-18)24(25,26)27/h4-15H,3,16H2,1-2H3/q+1 |
| InChIKey | OMNZAJAMAAWVTP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|