C20H16N4O2S — CID 9114221
N-(5-benzyl-1,3-thiazol-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 9114221) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-(5-benzyl-1,3-thiazol-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9114221 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-(5-benzyl-1,3-thiazol-2-yl)-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2ccccc12)Nc1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C20H16N4O2S/c25-18(11-17-15-8-4-5-9-16(15)19(26)24-23-17)22-20-21-12-14(27-20)10-13-6-2-1-3-7-13/h1-9,12H,10-11H2,(H,24,26)(H,21,22,25) |
| InChIKey | OTZYFBZJJRDXAN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |